C23H25N9OS2 — CID 154653535
6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653535) has the molecular formula C23H25N9OS2 and a molecular weight of 507.65 g/mol. Its IUPAC name is 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653535 |
| Molecular Formula | C23H25N9OS2 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5CCn6cnnc6C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C23H25N9OS2/c1-34-17-10-24-22(25-11-17)27-15-3-4-16(9-15)28-23-29-18-5-2-14(8-19(18)35-23)21(33)31-6-7-32-13-26-30-20(32)12-31/h2,5,8,10-11,13,15-16H,3-4,6-7,9,12H2,1H3,(H,28,29)(H,24,25,27)/t15-,16-/m0/s1 |
| InChIKey | DXPALDKJYRWLQJ-HOTGVXAUSA-N |
| XLogP | 3.50 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |