C26H27N7OS2 — CID 154653625
6,8-dihydro-5H-1,7-naphthyridin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653625) has the molecular formula C26H27N7OS2 and a molecular weight of 517.68 g/mol. Its IUPAC name is 6,8-dihydro-5H-1,7-naphthyridin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | 6,8-dihydro-5H-1,7-naphthyridin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653625 |
| Molecular Formula | C26H27N7OS2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 6,8-dihydro-5H-1,7-naphthyridin-7-yl-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5CCc6cccnc6C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C26H27N7OS2/c1-35-20-13-28-25(29-14-20)30-18-5-6-19(12-18)31-26-32-21-7-4-17(11-23(21)36-26)24(34)33-10-8-16-3-2-9-27-22(16)15-33/h2-4,7,9,11,13-14,18-19H,5-6,8,10,12,15H2,1H3,(H,31,32)(H,28,29,30)/t18-,19-/m0/s1 |
| InChIKey | YTXPEODNLSNXNS-OALUTQOASA-N |
| XLogP | 4.85 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |