C21H23F3N6O2S2 — CID 154653758
2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-benzothiazole-6-carboxamide (PubChem CID 154653758) has the molecular formula C21H23F3N6O2S2 and a molecular weight of 512.58 g/mol. Its IUPAC name is 2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 154653758 |
| Molecular Formula | C21H23F3N6O2S2 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-N-(3,3,3-trifluoro-2-hydroxypropyl)-1,3-benzothiazole-6-carboxamide |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)NCC(O)C(F)(F)F)cc4s3)C2)nc1 |
| InChI | InChI=1S/C21H23F3N6O2S2/c1-33-14-8-26-19(27-9-14)28-12-3-4-13(7-12)29-20-30-15-5-2-11(6-16(15)34-20)18(32)25-10-17(31)21(22,23)24/h2,5-6,8-9,12-13,17,31H,3-4,7,10H2,1H3,(H,25,32)(H,29,30)(H,26,27,28)/t12-,13-,17?/m0/s1 |
| InChIKey | RWGGLWHSUVDSGQ-RNWUTADCSA-N |
| XLogP | 3.91 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |