C22H26N6O3S2 — CID 154653913
[(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653913) has the molecular formula C22H26N6O3S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653913 |
| Molecular Formula | C22H26N6O3S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | [(3R,4S)-3,4-dihydroxypyrrolidin-1-yl]-[2-[[(1S,3S)-3-[(5-methylsulfanylpyrimidin-2-yl)amino]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(N[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5C[C@@H](O)[C@@H](O)C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C22H26N6O3S2/c1-32-15-8-23-21(24-9-15)25-13-3-4-14(7-13)26-22-27-16-5-2-12(6-19(16)33-22)20(31)28-10-17(29)18(30)11-28/h2,5-6,8-9,13-14,17-18,29-30H,3-4,7,10-11H2,1H3,(H,26,27)(H,23,24,25)/t13-,14-,17-,18+/m0/s1 |
| InChIKey | XBYFKJQXBFIXQK-DFEHZGFQSA-N |
| XLogP | 2.43 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |