C18H22N6OS2 — CID 154653938
N,N-dimethyl-2-[3-[(5-methylsulfanylpyrimidin-2-yl)amino]propylamino]-1,3-benzothiazole-6-carboxamide (PubChem CID 154653938) has the molecular formula C18H22N6OS2 and a molecular weight of 402.55 g/mol. Its IUPAC name is N,N-dimethyl-2-[3-[(5-methylsulfanylpyrimidin-2-yl)amino]propylamino]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N,N-dimethyl-2-[3-[(5-methylsulfanylpyrimidin-2-yl)amino]propylamino]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 154653938 |
| Molecular Formula | C18H22N6OS2 |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N,N-dimethyl-2-[3-[(5-methylsulfanylpyrimidin-2-yl)amino]propylamino]-1,3-benzothiazole-6-carboxamide |
| SMILES | CSc1cnc(NCCCNc2nc3ccc(C(=O)N(C)C)cc3s2)nc1 |
| InChI | InChI=1S/C18H22N6OS2/c1-24(2)16(25)12-5-6-14-15(9-12)27-18(23-14)20-8-4-7-19-17-21-10-13(26-3)11-22-17/h5-6,9-11H,4,7-8H2,1-3H3,(H,20,23)(H,19,21,22) |
| InChIKey | LEEVOIWIMNMRID-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|