C23H26N10OS2 — CID 154653993
6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[2-(5-methylsulfanylpyrimidin-2-yl)hydrazinyl]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone (PubChem CID 154653993) has the molecular formula C23H26N10OS2 and a molecular weight of 522.66 g/mol. Its IUPAC name is 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[2-(5-methylsulfanylpyrimidin-2-yl)hydrazinyl]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone.
| Compound Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[2-(5-methylsulfanylpyrimidin-2-yl)hydrazinyl]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
|---|---|
| PubChem CID | 154653993 |
| Molecular Formula | C23H26N10OS2 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl-[2-[[(1S,3S)-3-[2-(5-methylsulfanylpyrimidin-2-yl)hydrazinyl]cyclopentyl]amino]-1,3-benzothiazol-6-yl]methanone |
| SMILES | CSc1cnc(NN[C@H]2CC[C@H](Nc3nc4ccc(C(=O)N5CCn6cnnc6C5)cc4s3)C2)nc1 |
| InChI | InChI=1S/C23H26N10OS2/c1-35-17-10-24-22(25-11-17)31-29-16-4-3-15(9-16)27-23-28-18-5-2-14(8-19(18)36-23)21(34)32-6-7-33-13-26-30-20(33)12-32/h2,5,8,10-11,13,15-16,29H,3-4,6-7,9,12H2,1H3,(H,27,28)(H,24,25,31)/t15-,16-/m0/s1 |
| InChIKey | DOJKQUZGTZCOTB-HOTGVXAUSA-N |
| XLogP | 3.01 |
| TPSA | 125.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|