C16H22F2N6O — CID 154654037
2-[(1S,3S)-3-[(5-amino-2-pyridinyl)amino]cyclopentyl]-1-[(E)-2-(difluoromethoxy)prop-1-enyl]-3-methylideneguanidine (PubChem CID 154654037) has the molecular formula C16H22F2N6O and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[(1S,3S)-3-[(5-amino-2-pyridinyl)amino]cyclopentyl]-1-[(E)-2-(difluoromethoxy)prop-1-enyl]-3-methylideneguanidine.
| Compound Name | 2-[(1S,3S)-3-[(5-amino-2-pyridinyl)amino]cyclopentyl]-1-[(E)-2-(difluoromethoxy)prop-1-enyl]-3-methylideneguanidine |
|---|---|
| PubChem CID | 154654037 |
| Molecular Formula | C16H22F2N6O |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[(1S,3S)-3-[(5-amino-2-pyridinyl)amino]cyclopentyl]-1-[(E)-2-(difluoromethoxy)prop-1-enyl]-3-methylideneguanidine |
| SMILES | C=N/C(=N\[C@H]1CC[C@H](Nc2ccc(N)cn2)C1)N/C=C(\C)OC(F)F |
| InChI | InChI=1S/C16H22F2N6O/c1-10(25-15(17)18)8-22-16(20-2)24-13-5-4-12(7-13)23-14-6-3-11(19)9-21-14/h3,6,8-9,12-13,15H,2,4-5,7,19H2,1H3,(H,21,23)(H,22,24)/b10-8+/t12-,13-/m0/s1 |
| InChIKey | HXZMRQYWLMKGTR-SOWQLTKDSA-N |
| XLogP | 2.74 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|