C18H15FN6OS — CID 154654159
1-cyclopropyl-3-[5-[4-(5-fluorothiophen-2-yl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea (PubChem CID 154654159) has the molecular formula C18H15FN6OS and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-cyclopropyl-3-[5-[4-(5-fluorothiophen-2-yl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea.
| Compound Name | 1-cyclopropyl-3-[5-[4-(5-fluorothiophen-2-yl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 154654159 |
| Molecular Formula | C18H15FN6OS |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-cyclopropyl-3-[5-[4-(5-fluorothiophen-2-yl)-1H-benzimidazol-2-yl]-1H-pyrazol-4-yl]urea |
| SMILES | O=C(Nc1cn[nH]c1-c1nc2c(-c3ccc(F)s3)cccc2[nH]1)NC1CC1 |
| InChI | InChI=1S/C18H15FN6OS/c19-14-7-6-13(27-14)10-2-1-3-11-15(10)24-17(22-11)16-12(8-20-25-16)23-18(26)21-9-4-5-9/h1-3,6-9H,4-5H2,(H,20,25)(H,22,24)(H2,21,23,26) |
| InChIKey | ITEYTGJOBFVWAP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |