C12H17N3 — CID 154654247
5-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine-3,4-diamine (PubChem CID 154654247) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 5-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine-3,4-diamine.
| Compound Name | 5-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 154654247 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 5-[(2E,4Z)-hepta-2,4-dien-3-yl]pyridine-3,4-diamine |
| SMILES | C/C=C(\C=C/CC)c1cncc(N)c1N |
| InChI | InChI=1S/C12H17N3/c1-3-5-6-9(4-2)10-7-15-8-11(13)12(10)14/h4-8H,3,13H2,1-2H3,(H2,14,15)/b6-5-,9-4+ |
| InChIKey | JFBYQUDETJIQGO-CXBDEZGUSA-N |
| XLogP | 2.62 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|