C14H16N4O2 — CID 154654592
N-(oxan-4-yl)-4-pyridin-3-yl-1H-pyrazole-5-carboxamide (PubChem CID 154654592) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(oxan-4-yl)-4-pyridin-3-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(oxan-4-yl)-4-pyridin-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 154654592 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(oxan-4-yl)-4-pyridin-3-yl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCOCC1)c1[nH]ncc1-c1cccnc1 |
| InChI | InChI=1S/C14H16N4O2/c19-14(17-11-3-6-20-7-4-11)13-12(9-16-18-13)10-2-1-5-15-8-10/h1-2,5,8-9,11H,3-4,6-7H2,(H,16,18)(H,17,19) |
| InChIKey | CBRWUMJBRVQGEA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |