About 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine
6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine (PubChem CID 154655711) has the molecular formula C15H18BrN3O2
and a molecular weight of 352.23 g/mol. Its IUPAC name is 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine |
| PubChem CID | 154655711 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine |
| SMILES | CC(C)Oc1nc(Br)cn2cc(C34COC(C)(C3)C4)nc12 |
| InChI | InChI=1S/C15H18BrN3O2/c1-9(2)21-13-12-17-10(4-19(12)5-11(16)18-13)15-6-14(3,7-15)20-8-15/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | UPAYGFPPTLOJKC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine?
The IUPAC name of 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine (CID 154655711) is 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine.
What is the SMILES notation for 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine?
The canonical SMILES for 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine is CC(C)Oc1nc(Br)cn2cc(C34COC(C)(C3)C4)nc12.
What is the InChIKey of 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine?
The InChIKey is UPAYGFPPTLOJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN3O2/c1-9(2)21-13-12-17-10(4-19(12)5-11(16)18-13)15-6-14(3,7-15)20-8-15/h4-5,9H,6-8H2,1-3H3.
What are the key properties of 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine?
6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine has a molecular weight of 352.23 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(1-methyl-2-oxabicyclo[2.1.1]hexan-4-yl)-8-propan-2-yloxyimidazo[1,2-a]pyrazine is sourced from PubChem (CID 154655711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).