C25H25F3O2 — CID 154656084
(E)-3-[3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-4-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 154656084) has the molecular formula C25H25F3O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is (E)-3-[3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-4-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 154656084 |
| Molecular Formula | C25H25F3O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-3-[3-(3,5,5,8,8-pentamethylnaphthalen-2-yl)-4-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | Cc1cc2c(cc1-c1cc(/C=C/C(=O)O)ccc1C(F)(F)F)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C25H25F3O2/c1-15-12-20-21(24(4,5)11-10-23(20,2)3)14-17(15)18-13-16(7-9-22(29)30)6-8-19(18)25(26,27)28/h6-14H,1-5H3,(H,29,30)/b9-7+ |
| InChIKey | DJJJLUPXASJWAC-VQHVLOKHSA-N |
| XLogP | 6.90 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|