About 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid
6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid (PubChem CID 154656164) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid |
| PubChem CID | 154656164 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid |
| SMILES | Cc1cc(C(C)(C)C)cc(Nc2ccc(C(=O)O)c(C)n2)c1C |
| InChI | InChI=1S/C19H24N2O2/c1-11-9-14(19(4,5)6)10-16(12(11)2)21-17-8-7-15(18(22)23)13(3)20-17/h7-10H,1-6H3,(H,20,21)(H,22,23) |
| InChIKey | KGEHJEKJSVLRQX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid?
The IUPAC name of 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid (CID 154656164) is 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid.
What is the SMILES notation for 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid?
The canonical SMILES for 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid is Cc1cc(C(C)(C)C)cc(Nc2ccc(C(=O)O)c(C)n2)c1C.
What is the InChIKey of 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid?
The InChIKey is KGEHJEKJSVLRQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2/c1-11-9-14(19(4,5)6)10-16(12(11)2)21-17-8-7-15(18(22)23)13(3)20-17/h7-10H,1-6H3,(H,20,21)(H,22,23).
What are the key properties of 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid?
6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid has a molecular weight of 312.41 g/mol, XLogP of 4.75, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-tert-butyl-2,3-dimethylanilino)-2-methylpyridine-3-carboxylic acid is sourced from PubChem (CID 154656164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).