About ethane;2-ethyl-3,4-dimethylfuran
ethane;2-ethyl-3,4-dimethylfuran (PubChem CID 154656296) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is ethane;2-ethyl-3,4-dimethylfuran.
Molecular Properties
| Compound Name | ethane;2-ethyl-3,4-dimethylfuran |
| PubChem CID | 154656296 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | ethane;2-ethyl-3,4-dimethylfuran |
| SMILES | CC.CCc1occ(C)c1C |
| InChI | InChI=1S/C8H12O.C2H6/c1-4-8-7(3)6(2)5-9-8;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | JHDBMJCUMNYAOR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethyl-3,4-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-3,4-dimethylfuran?
The IUPAC name of ethane;2-ethyl-3,4-dimethylfuran (CID 154656296) is ethane;2-ethyl-3,4-dimethylfuran.
What is the SMILES notation for ethane;2-ethyl-3,4-dimethylfuran?
The canonical SMILES for ethane;2-ethyl-3,4-dimethylfuran is CC.CCc1occ(C)c1C.
What is the InChIKey of ethane;2-ethyl-3,4-dimethylfuran?
The InChIKey is JHDBMJCUMNYAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C2H6/c1-4-8-7(3)6(2)5-9-8;1-2/h5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-ethyl-3,4-dimethylfuran?
ethane;2-ethyl-3,4-dimethylfuran has a molecular weight of 154.25 g/mol, XLogP of 3.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-3,4-dimethylfuran is sourced from PubChem (CID 154656296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).