About 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one
3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one (PubChem CID 154656895) has the molecular formula C20H16FN5O
and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one |
| PubChem CID | 154656895 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one |
| SMILES | CNc1cc(-c2nc3c(=O)cc[nH]c3nc2-c2ccc(F)cc2)cc(C)n1 |
| InChI | InChI=1S/C20H16FN5O/c1-11-9-13(10-16(22-2)24-11)18-17(12-3-5-14(21)6-4-12)26-20-19(25-18)15(27)7-8-23-20/h3-10H,1-2H3,(H,22,24)(H,23,26,27) |
| InChIKey | SESCCNIHKCXXKV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one?
The IUPAC name of 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one (CID 154656895) is 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one.
What is the SMILES notation for 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one?
The canonical SMILES for 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one is CNc1cc(-c2nc3c(=O)cc[nH]c3nc2-c2ccc(F)cc2)cc(C)n1.
What is the InChIKey of 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one?
The InChIKey is SESCCNIHKCXXKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16FN5O/c1-11-9-13(10-16(22-2)24-11)18-17(12-3-5-14(21)6-4-12)26-20-19(25-18)15(27)7-8-23-20/h3-10H,1-2H3,(H,22,24)(H,23,26,27).
What are the key properties of 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one?
3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one has a molecular weight of 361.38 g/mol, XLogP of 3.54, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2-[2-methyl-6-(methylamino)-4-pyridinyl]-5H-pyrido[2,3-b]pyrazin-8-one is sourced from PubChem (CID 154656895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).