About 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one
2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one (PubChem CID 154657118) has the molecular formula C20H10ClFN4OS
and a molecular weight of 408.85 g/mol. Its IUPAC name is 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one.
Molecular Properties
| Compound Name | 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one |
| PubChem CID | 154657118 |
| Molecular Formula | C20H10ClFN4OS |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one |
| SMILES | O=c1ccc2nc(-c3cc(Cl)c4ncsc4c3)c(-c3ccc(F)cc3)nc2[nH]1 |
| InChI | InChI=1S/C20H10ClFN4OS/c21-13-7-11(8-15-19(13)23-9-28-15)18-17(10-1-3-12(22)4-2-10)26-20-14(24-18)5-6-16(27)25-20/h1-9H,(H,25,26,27) |
| InChIKey | QJRHFZOWQMUOHE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one?
The IUPAC name of 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one (CID 154657118) is 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one.
What is the SMILES notation for 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one?
The canonical SMILES for 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one is O=c1ccc2nc(-c3cc(Cl)c4ncsc4c3)c(-c3ccc(F)cc3)nc2[nH]1.
What is the InChIKey of 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one?
The InChIKey is QJRHFZOWQMUOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10ClFN4OS/c21-13-7-11(8-15-19(13)23-9-28-15)18-17(10-1-3-12(22)4-2-10)26-20-14(24-18)5-6-16(27)25-20/h1-9H,(H,25,26,27).
What are the key properties of 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one?
2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one has a molecular weight of 408.85 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-1,3-benzothiazol-6-yl)-3-(4-fluorophenyl)-5H-pyrido[2,3-b]pyrazin-6-one is sourced from PubChem (CID 154657118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).