About 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene
1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene (PubChem CID 15465808) has the molecular formula C21H28Cl2N2Ru
and a molecular weight of 480.45 g/mol. Its IUPAC name is 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene |
| PubChem CID | 15465808 |
| Molecular Formula | C21H28Cl2N2Ru |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene |
| SMILES | C1=NCCCN1Cc1ccccc1.Cc1ccc(C(C)C)cc1.Cl[Ru]Cl |
| InChI | InChI=1S/C11H14N2.C10H14.2ClH.Ru/c1-2-5-11(6-3-1)9-13-8-4-7-12-10-13;1-8(2)10-6-4-9(3)5-7-10;;;/h1-3,5-6,10H,4,7-9H2;4-8H,1-3H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | OFJLUTLDKIFKNT-UHFFFAOYSA-L |
| XLogP | 6.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene?
The IUPAC name of 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene (CID 15465808) is 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene.
What is the SMILES notation for 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene?
The canonical SMILES for 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene is C1=NCCCN1Cc1ccccc1.Cc1ccc(C(C)C)cc1.Cl[Ru]Cl.
What is the InChIKey of 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene?
The InChIKey is OFJLUTLDKIFKNT-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H14N2.C10H14.2ClH.Ru/c1-2-5-11(6-3-1)9-13-8-4-7-12-10-13;1-8(2)10-6-4-9(3)5-7-10;;;/h1-3,5-6,10H,4,7-9H2;4-8H,1-3H3;2*1H;/q;;;;+2/p-2.
What are the key properties of 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene?
1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene has a molecular weight of 480.45 g/mol, XLogP of 6.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,6-dihydro-4H-pyrimidine;dichlororuthenium;1-methyl-4-propan-2-ylbenzene is sourced from PubChem (CID 15465808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).