C24H26F3N5O3 — CID 154658659
5-(cyclopentylmethyl)-N-[4-[5-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 154658659) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is 5-(cyclopentylmethyl)-N-[4-[5-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-(cyclopentylmethyl)-N-[4-[5-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 154658659 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-(cyclopentylmethyl)-N-[4-[5-(2-methoxyethoxy)-2-(trifluoromethyl)phenyl]-2-pyridinyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)c(-c2ccnc(NC(=O)c3n[nH]c(CC4CCCC4)n3)c2)c1 |
| InChI | InChI=1S/C24H26F3N5O3/c1-34-10-11-35-17-6-7-19(24(25,26)27)18(14-17)16-8-9-28-20(13-16)30-23(33)22-29-21(31-32-22)12-15-4-2-3-5-15/h6-9,13-15H,2-5,10-12H2,1H3,(H,28,30,33)(H,29,31,32) |
| InChIKey | YVLHMCOANOODOH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|