C27H28F3NO10S6 — CID 154659180
3-[3,6-bis(3-sulfopropylsulfanyl)-8-[(2,2,2-trifluoroacetyl)amino]pyren-1-yl]sulfanylpropane-1-sulfonic acid (PubChem CID 154659180) has the molecular formula C27H28F3NO10S6 and a molecular weight of 775.91 g/mol. Its IUPAC name is 3-[3,6-bis(3-sulfopropylsulfanyl)-8-[(2,2,2-trifluoroacetyl)amino]pyren-1-yl]sulfanylpropane-1-sulfonic acid.
| Compound Name | 3-[3,6-bis(3-sulfopropylsulfanyl)-8-[(2,2,2-trifluoroacetyl)amino]pyren-1-yl]sulfanylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 154659180 |
| Molecular Formula | C27H28F3NO10S6 |
| Molecular Weight | 775.91 g/mol |
| Exact Mass | 775.00 |
| IUPAC Name | 3-[3,6-bis(3-sulfopropylsulfanyl)-8-[(2,2,2-trifluoroacetyl)amino]pyren-1-yl]sulfanylpropane-1-sulfonic acid |
| SMILES | O=C(Nc1cc(SCCCS(=O)(=O)O)c2ccc3c(SCCCS(=O)(=O)O)cc(SCCCS(=O)(=O)O)c4ccc1c2c43)C(F)(F)F |
| InChI | InChI=1S/C27H28F3NO10S6/c28-27(29,30)26(32)31-20-14-21(42-8-1-11-45(33,34)35)17-6-7-19-23(44-10-3-13-47(39,40)41)15-22(43-9-2-12-46(36,37)38)18-5-4-16(20)24(17)25(18)19/h4-7,14-15H,1-3,8-13H2,(H,31,32)(H,33,34,35)(H,36,37,38)(H,39,40,41) |
| InChIKey | UUTWIRZCMNOTRN-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 192.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.91 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|