About N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide
N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide (PubChem CID 154659700) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide.
Molecular Properties
| Compound Name | N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide |
| PubChem CID | 154659700 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide |
| SMILES | N/C(=N\O)c1cccc2c1CCOC2 |
| InChI | InChI=1S/C10H12N2O2/c11-10(12-13)9-3-1-2-7-6-14-5-4-8(7)9/h1-3,13H,4-6H2,(H2,11,12) |
| InChIKey | NWOGHUBAVDJACR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide?
The IUPAC name of N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide (CID 154659700) is N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide.
What is the SMILES notation for N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide?
The canonical SMILES for N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide is N/C(=N\O)c1cccc2c1CCOC2.
What is the InChIKey of N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide?
The InChIKey is NWOGHUBAVDJACR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c11-10(12-13)9-3-1-2-7-6-14-5-4-8(7)9/h1-3,13H,4-6H2,(H2,11,12).
What are the key properties of N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide?
N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide has a molecular weight of 192.22 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3,4-dihydro-1H-isochromene-5-carboximidamide is sourced from PubChem (CID 154659700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).