C16H21F17O2S — CID 154660244
1,1,2,2,3,3,3-heptafluoropropan-1-ol;1,1,2,2,3,3-hexafluoro-4-methylpentan-1-ol;3,3,4,4-tetrafluoro-5-methylhexane-1-thiol (PubChem CID 154660244) has the molecular formula C16H21F17O2S and a molecular weight of 600.37 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropan-1-ol;1,1,2,2,3,3-hexafluoro-4-methylpentan-1-ol;3,3,4,4-tetrafluoro-5-methylhexane-1-thiol.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropan-1-ol;1,1,2,2,3,3-hexafluoro-4-methylpentan-1-ol;3,3,4,4-tetrafluoro-5-methylhexane-1-thiol |
|---|---|
| PubChem CID | 154660244 |
| Molecular Formula | C16H21F17O2S |
| Molecular Weight | 600.37 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropan-1-ol;1,1,2,2,3,3-hexafluoro-4-methylpentan-1-ol;3,3,4,4-tetrafluoro-5-methylhexane-1-thiol |
| SMILES | CC(C)C(F)(F)C(F)(F)C(O)(F)F.CC(C)C(F)(F)C(F)(F)CCS.OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H12F4S.C6H8F6O.C3HF7O/c1-5(2)7(10,11)6(8,9)3-4-12;1-3(2)4(7,8)5(9,10)6(11,12)13;4-1(5,2(6,7)8)3(9,10)11/h5,12H,3-4H2,1-2H3;3,13H,1-2H3;11H |
| InChIKey | ZUMXNWCDOJRZKD-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.37 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|