C36H50N4O2 — CID 154660888
(E)-1-[4-[(E)-but-2-en-2-yl]phenyl]-2-methyl-N-[1-(1-methylpyrrolidin-3-yl)ethenoxy]propan-1-imine;1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methoxymethyl)benzene;methanimidamide (PubChem CID 154660888) has the molecular formula C36H50N4O2 and a molecular weight of 570.82 g/mol. Its IUPAC name is (E)-1-[4-[(E)-but-2-en-2-yl]phenyl]-2-methyl-N-[1-(1-methylpyrrolidin-3-yl)ethenoxy]propan-1-imine;1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methoxymethyl)benzene;methanimidamide.
| Compound Name | (E)-1-[4-[(E)-but-2-en-2-yl]phenyl]-2-methyl-N-[1-(1-methylpyrrolidin-3-yl)ethenoxy]propan-1-imine;1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methoxymethyl)benzene;methanimidamide |
|---|---|
| PubChem CID | 154660888 |
| Molecular Formula | C36H50N4O2 |
| Molecular Weight | 570.82 g/mol |
| Exact Mass | 570.39 |
| IUPAC Name | (E)-1-[4-[(E)-but-2-en-2-yl]phenyl]-2-methyl-N-[1-(1-methylpyrrolidin-3-yl)ethenoxy]propan-1-imine;1-[(3E)-hexa-1,3,5-trien-3-yl]-3-(methoxymethyl)benzene;methanimidamide |
| SMILES | C=C(O/N=C(/c1ccc(/C(C)=C/C)cc1)C(C)C)C1CCN(C)C1.C=C/C=C(\C=C)c1cccc(COC)c1.[H]/N=C/N |
| InChI | InChI=1S/C21H30N2O.C14H16O.CH4N2/c1-7-16(4)18-8-10-19(11-9-18)21(15(2)3)22-24-17(5)20-12-13-23(6)14-20;1-4-7-13(5-2)14-9-6-8-12(10-14)11-15-3;2-1-3/h7-11,15,20H,5,12-14H2,1-4,6H3;4-10H,1-2,11H2,3H3;1H,(H3,2,3)/b16-7+,22-21+;13-7+; |
| InChIKey | ZWQDQFPUZXDAHQ-UBYZRTARSA-N |
| XLogP | 8.09 |
| TPSA | 83.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.82 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|