C24H14BF15N- — CID 15466118
2-(tert-butylamino)ethyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 15466118) has the molecular formula C24H14BF15N- and a molecular weight of 612.17 g/mol. Its IUPAC name is 2-(tert-butylamino)ethyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 2-(tert-butylamino)ethyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 15466118 |
| Molecular Formula | C24H14BF15N- |
| Molecular Weight | 612.17 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 2-(tert-butylamino)ethyl-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CC(C)(C)NCC[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H14BF15N/c1-24(2,3)41-5-4-25(6-9(26)15(32)21(38)16(33)10(6)27,7-11(28)17(34)22(39)18(35)12(7)29)8-13(30)19(36)23(40)20(37)14(8)31/h41H,4-5H2,1-3H3/q-1 |
| InChIKey | UHRLAPOJIATUDW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.17 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|