About molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate
molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate (PubChem CID 154661279) has the molecular formula C12H28N2O2
and a molecular weight of 232.37 g/mol. Its IUPAC name is molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate.
Molecular Properties
| Compound Name | molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate |
| PubChem CID | 154661279 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate |
| SMILES | CCCN(CC)CCCNC(=O)OC(C)C.[H][H] |
| InChI | InChI=1S/C12H26N2O2.H2/c1-5-9-14(6-2)10-7-8-13-12(15)16-11(3)4;/h11H,5-10H2,1-4H3,(H,13,15);1H |
| InChIKey | LQTVBZZDCUUFPD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate?
The IUPAC name of molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate (CID 154661279) is molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate.
What is the SMILES notation for molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate?
The canonical SMILES for molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate is CCCN(CC)CCCNC(=O)OC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate?
The InChIKey is LQTVBZZDCUUFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2.H2/c1-5-9-14(6-2)10-7-8-13-12(15)16-11(3)4;/h11H,5-10H2,1-4H3,(H,13,15);1H.
What are the key properties of molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate?
molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate has a molecular weight of 232.37 g/mol, XLogP of 2.49, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;propan-2-yl N-[3-[ethyl(propyl)amino]propyl]carbamate is sourced from PubChem (CID 154661279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).