About cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine
cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine (PubChem CID 154661636) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine |
| PubChem CID | 154661636 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine |
| SMILES | CO[C@@]1(C)CCC[C@H](NCC(C)C)C1 |
| InChI | InChI=1S/C12H25NO/c1-10(2)9-13-11-6-5-7-12(3,8-11)14-4/h10-11,13H,5-9H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | JISXSGCXJGQFKD-RYUDHWBXSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine?
The IUPAC name of cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine (CID 154661636) is cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine.
What is the SMILES notation for cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine?
The canonical SMILES for cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine is CO[C@@]1(C)CCC[C@H](NCC(C)C)C1.
What is the InChIKey of cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine?
The InChIKey is JISXSGCXJGQFKD-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H25NO/c1-10(2)9-13-11-6-5-7-12(3,8-11)14-4/h10-11,13H,5-9H2,1-4H3/t11-,12-/m0/s1.
What are the key properties of cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine?
cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine has a molecular weight of 199.34 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3S)-3-methoxy-3-methyl-N-(2-methylpropyl)cyclohexan-1-amine is sourced from PubChem (CID 154661636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).