About 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid
5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid (PubChem CID 154661738) has the molecular formula C22H22N4O5
and a molecular weight of 422.44 g/mol. Its IUPAC name is 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid |
| PubChem CID | 154661738 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid |
| SMILES | Nc1nc(-c2ccc(-c3ccc(O)c(C(=O)O)c3)cc2OC2CCCC2)[nH]c(=O)c1N |
| InChI | InChI=1S/C22H22N4O5/c23-18-19(24)25-20(26-21(18)28)14-7-5-12(10-17(14)31-13-3-1-2-4-13)11-6-8-16(27)15(9-11)22(29)30/h5-10,13,27H,1-4,23H2,(H,29,30)(H3,24,25,26,28) |
| InChIKey | KEHCVPGHFXZTBY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid?
The IUPAC name of 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid (CID 154661738) is 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid is Nc1nc(-c2ccc(-c3ccc(O)c(C(=O)O)c3)cc2OC2CCCC2)[nH]c(=O)c1N.
What is the InChIKey of 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid?
The InChIKey is KEHCVPGHFXZTBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O5/c23-18-19(24)25-20(26-21(18)28)14-7-5-12(10-17(14)31-13-3-1-2-4-13)11-6-8-16(27)15(9-11)22(29)30/h5-10,13,27H,1-4,23H2,(H,29,30)(H3,24,25,26,28).
What are the key properties of 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid?
5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid has a molecular weight of 422.44 g/mol, XLogP of 2.99, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-cyclopentyloxy-4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)phenyl]-2-hydroxybenzoic acid is sourced from PubChem (CID 154661738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).