About 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid
3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid (PubChem CID 154661877) has the molecular formula C19H17FN4O4
and a molecular weight of 384.37 g/mol. Its IUPAC name is 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid |
| PubChem CID | 154661877 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid |
| SMILES | CCOc1cc(-c2cccc(C(=O)O)c2F)ccc1-c1nc(N)c(N)c(=O)[nH]1 |
| InChI | InChI=1S/C19H17FN4O4/c1-2-28-13-8-9(10-4-3-5-12(14(10)20)19(26)27)6-7-11(13)17-23-16(22)15(21)18(25)24-17/h3-8H,2,21H2,1H3,(H,26,27)(H3,22,23,24,25) |
| InChIKey | LTADZXXASVEJCR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid?
The IUPAC name of 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid (CID 154661877) is 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid.
What is the SMILES notation for 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid?
The canonical SMILES for 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid is CCOc1cc(-c2cccc(C(=O)O)c2F)ccc1-c1nc(N)c(N)c(=O)[nH]1.
What is the InChIKey of 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid?
The InChIKey is LTADZXXASVEJCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4O4/c1-2-28-13-8-9(10-4-3-5-12(14(10)20)19(26)27)6-7-11(13)17-23-16(22)15(21)18(25)24-17/h3-8H,2,21H2,1H3,(H,26,27)(H3,22,23,24,25).
What are the key properties of 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid?
3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid has a molecular weight of 384.37 g/mol, XLogP of 2.50, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)-3-ethoxyphenyl]-2-fluorobenzoic acid is sourced from PubChem (CID 154661877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).