About 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine
4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine (PubChem CID 154662083) has the molecular formula C14H13N
and a molecular weight of 195.26 g/mol. Its IUPAC name is 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine.
Molecular Properties
| Compound Name | 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine |
| PubChem CID | 154662083 |
| Molecular Formula | C14H13N |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine |
| SMILES | Cc1c(-c2ccncc2)ccc2c1CC2 |
| InChI | InChI=1S/C14H13N/c1-10-13-4-2-11(13)3-5-14(10)12-6-8-15-9-7-12/h3,5-9H,2,4H2,1H3 |
| InChIKey | XTFQCSHBPMCBAU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine?
The IUPAC name of 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine (CID 154662083) is 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine.
What is the SMILES notation for 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine?
The canonical SMILES for 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine is Cc1c(-c2ccncc2)ccc2c1CC2.
What is the InChIKey of 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine?
The InChIKey is XTFQCSHBPMCBAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N/c1-10-13-4-2-11(13)3-5-14(10)12-6-8-15-9-7-12/h3,5-9H,2,4H2,1H3.
What are the key properties of 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine?
4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine has a molecular weight of 195.26 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)pyridine is sourced from PubChem (CID 154662083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).