C21H26N6O3S2 — CID 154662167
1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea (PubChem CID 154662167) has the molecular formula C21H26N6O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea.
| Compound Name | 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
|---|---|
| PubChem CID | 154662167 |
| Molecular Formula | C21H26N6O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-[(cyanoamino)-[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-oxo-λ6-sulfanylidene]-3-(4,4-dimethyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-yl)urea |
| SMILES | CC(C)(O)c1ncc(S(=O)(=NC(=O)Nc2c3c(nc4c2CCC4(C)C)CCC3)NC#N)s1 |
| InChI | InChI=1S/C21H26N6O3S2/c1-20(2)9-8-13-16(12-6-5-7-14(12)25-17(13)20)26-19(28)27-32(30,24-11-22)15-10-23-18(31-15)21(3,4)29/h10,29H,5-9H2,1-4H3,(H2,24,25,26,27,28,30) |
| InChIKey | HDICVRJXXSWHGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|