About 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one
6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one (PubChem CID 154662363) has the molecular formula C19H21F2N3O2
and a molecular weight of 361.39 g/mol. Its IUPAC name is 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one.
Molecular Properties
| Compound Name | 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one |
| PubChem CID | 154662363 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one |
| SMILES | Cn1nc(CC(=O)N2CCC(Cc3cc(F)cc(F)c3)CC2)ccc1=O |
| InChI | InChI=1S/C19H21F2N3O2/c1-23-18(25)3-2-17(22-23)12-19(26)24-6-4-13(5-7-24)8-14-9-15(20)11-16(21)10-14/h2-3,9-11,13H,4-8,12H2,1H3 |
| InChIKey | DQWOHDGNPVWDAL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one?
The IUPAC name of 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one (CID 154662363) is 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one.
What is the SMILES notation for 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one?
The canonical SMILES for 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one is Cn1nc(CC(=O)N2CCC(Cc3cc(F)cc(F)c3)CC2)ccc1=O.
What is the InChIKey of 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one?
The InChIKey is DQWOHDGNPVWDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2N3O2/c1-23-18(25)3-2-17(22-23)12-19(26)24-6-4-13(5-7-24)8-14-9-15(20)11-16(21)10-14/h2-3,9-11,13H,4-8,12H2,1H3.
What are the key properties of 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one?
6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one has a molecular weight of 361.39 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[4-[(3,5-difluorophenyl)methyl]piperidin-1-yl]-2-oxoethyl]-2-methylpyridazin-3-one is sourced from PubChem (CID 154662363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).