C9H13F3N4O2 — CID 154662972
3-nitroso-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 154662972) has the molecular formula C9H13F3N4O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 3-nitroso-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | 3-nitroso-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 154662972 |
| Molecular Formula | C9H13F3N4O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 3-nitroso-N-(2,2,2-trifluoroethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | O=NN1CC2CCC(C1)N2C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N4O2/c10-9(11,12)5-13-8(17)16-6-1-2-7(16)4-15(3-6)14-18/h6-7H,1-5H2,(H,13,17) |
| InChIKey | BKXRADSIPBQYME-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|