C13H16N6O2 — CID 154663210
4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-5-methyl-8H-pteridine-6,7-dione (PubChem CID 154663210) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-5-methyl-8H-pteridine-6,7-dione.
| Compound Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-5-methyl-8H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 154663210 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-[(1S,5R)-3,8-diazabicyclo[3.2.1]octan-3-yl]-5-methyl-8H-pteridine-6,7-dione |
| SMILES | Cn1c(=O)c(=O)[nH]c2ncnc(N3C[C@H]4CC[C@@H](C3)N4)c21 |
| InChI | InChI=1S/C13H16N6O2/c1-18-9-10(17-12(20)13(18)21)14-6-15-11(9)19-4-7-2-3-8(5-19)16-7/h6-8,16H,2-5H2,1H3,(H,14,15,17,20)/t7-,8+ |
| InChIKey | TYXXFOFANYNTCY-OCAPTIKFSA-N |
| XLogP | -1.04 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|