About 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine
2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine (PubChem CID 154663265) has the molecular formula C7H4Cl2F2N2
and a molecular weight of 225.02 g/mol. Its IUPAC name is 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine |
| PubChem CID | 154663265 |
| Molecular Formula | C7H4Cl2F2N2 |
| Molecular Weight | 225.02 g/mol |
| Exact Mass | 223.97 |
| IUPAC Name | 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine |
| SMILES | FC1(F)CCc2c(Cl)nc(Cl)nc21 |
| InChI | InChI=1S/C7H4Cl2F2N2/c8-5-3-1-2-7(10,11)4(3)12-6(9)13-5/h1-2H2 |
| InChIKey | LVDYMQUENGQVEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine?
The IUPAC name of 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine (CID 154663265) is 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine.
What is the SMILES notation for 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine?
The canonical SMILES for 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine is FC1(F)CCc2c(Cl)nc(Cl)nc21.
What is the InChIKey of 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine?
The InChIKey is LVDYMQUENGQVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2F2N2/c8-5-3-1-2-7(10,11)4(3)12-6(9)13-5/h1-2H2.
What are the key properties of 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine?
2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine has a molecular weight of 225.02 g/mol, XLogP of 2.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-7,7-difluoro-5,6-dihydrocyclopenta[d]pyrimidine is sourced from PubChem (CID 154663265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).