About ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate
ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate (PubChem CID 154663343) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
| PubChem CID | 154663343 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate |
| SMILES | CCOC(=O)c1c(C)cn2c1CCC2 |
| InChI | InChI=1S/C11H15NO2/c1-3-14-11(13)10-8(2)7-12-6-4-5-9(10)12/h7H,3-6H2,1-2H3 |
| InChIKey | AJBIROVQYVHEQU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate?
The IUPAC name of ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate (CID 154663343) is ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate.
What is the SMILES notation for ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate?
The canonical SMILES for ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate is CCOC(=O)c1c(C)cn2c1CCC2.
What is the InChIKey of ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate?
The InChIKey is AJBIROVQYVHEQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-3-14-11(13)10-8(2)7-12-6-4-5-9(10)12/h7H,3-6H2,1-2H3.
What are the key properties of ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate?
ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate has a molecular weight of 193.25 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-6,7-dihydro-5H-pyrrolizine-1-carboxylate is sourced from PubChem (CID 154663343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).