C19H27LrN6O3- — CID 154664668
[3-[[3-[(1,3-dimethylpyrazole-4-carbonyl)amino]-1H-pyrazol-5-yl]methyl]cyclopentyl] N-propylcarbamate;lawrencium (PubChem CID 154664668) has the molecular formula C19H27LrN6O3- and a molecular weight of 649.46 g/mol. Its IUPAC name is [3-[[3-[(1,3-dimethylpyrazole-4-carbonyl)amino]-1H-pyrazol-5-yl]methyl]cyclopentyl] N-propylcarbamate;lawrencium.
| Compound Name | [3-[[3-[(1,3-dimethylpyrazole-4-carbonyl)amino]-1H-pyrazol-5-yl]methyl]cyclopentyl] N-propylcarbamate;lawrencium |
|---|---|
| PubChem CID | 154664668 |
| Molecular Formula | C19H27LrN6O3- |
| Molecular Weight | 649.46 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | [3-[[3-[(1,3-dimethylpyrazole-4-carbonyl)amino]-1H-pyrazol-5-yl]methyl]cyclopentyl] N-propylcarbamate;lawrencium |
| SMILES | CCCNC(=O)OC1CCC([CH-]c2cc(NC(=O)c3cn(C)nc3C)n[nH]2)C1.[Lr] |
| InChI | InChI=1S/C19H27N6O3.Lr/c1-4-7-20-19(27)28-15-6-5-13(9-15)8-14-10-17(23-22-14)21-18(26)16-11-25(3)24-12(16)2;/h8,10-11,13,15H,4-7,9H2,1-3H3,(H,20,27)(H2,21,22,23,26);/q-1; |
| InChIKey | HOZTVTPXUWXRRD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|