C9H12N2O5S — CID 154664844
5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-thiazole-3-carboxamide (PubChem CID 154664844) has the molecular formula C9H12N2O5S and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-thiazole-3-carboxamide.
| Compound Name | 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-thiazole-3-carboxamide |
|---|---|
| PubChem CID | 154664844 |
| Molecular Formula | C9H12N2O5S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2-thiazole-3-carboxamide |
| SMILES | NC(=O)c1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)sn1 |
| InChI | InChI=1S/C9H12N2O5S/c10-9(15)3-1-5(17-11-3)8-7(14)6(13)4(2-12)16-8/h1,4,6-8,12-14H,2H2,(H2,10,15)/t4-,6-,7-,8+/m1/s1 |
| InChIKey | ZRXXJDFMZZQFJT-JBBNEOJLSA-N |
| XLogP | -1.60 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |