C20H21Cl2N3O — CID 154664873
N'-[2-chloro-4-[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 154664873) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is N'-[2-chloro-4-[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2-chloro-4-[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 154664873 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N'-[2-chloro-4-[3-(2-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-5-methylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(C2CC(c3ccccc3Cl)=NO2)cc1Cl |
| InChI | InChI=1S/C20H21Cl2N3O/c1-4-25(3)12-23-19-9-13(2)15(10-17(19)22)20-11-18(24-26-20)14-7-5-6-8-16(14)21/h5-10,12,20H,4,11H2,1-3H3/b23-12+ |
| InChIKey | IBORNYRVGLALNL-FSJBWODESA-N |
| XLogP | 5.78 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|