C20H21ClFN3O — CID 154664963
N'-[4-[3-(4-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide (PubChem CID 154664963) has the molecular formula C20H21ClFN3O and a molecular weight of 373.86 g/mol. Its IUPAC name is N'-[4-[3-(4-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-[3-(4-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 154664963 |
| Molecular Formula | C20H21ClFN3O |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | N'-[4-[3-(4-chloro-2-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,5-dimethylphenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(C2CC(c3ccc(Cl)cc3F)=NO2)c(C)cc1/N=C/N(C)C |
| InChI | InChI=1S/C20H21ClFN3O/c1-12-8-18(23-11-25(3)4)13(2)7-16(12)20-10-19(24-26-20)15-6-5-14(21)9-17(15)22/h5-9,11,20H,10H2,1-4H3/b23-11+ |
| InChIKey | YRLZVLWVUKYGQU-FOKLQQMPSA-N |
| XLogP | 5.18 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|