About 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide
6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide (PubChem CID 154665755) has the molecular formula C19H30FNO
and a molecular weight of 307.45 g/mol. Its IUPAC name is 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide.
Molecular Properties
| Compound Name | 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide |
| PubChem CID | 154665755 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide |
| SMILES | CC1(F)CCC(NC(=O)CCCCCC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C19H30FNO/c1-19(20)14-12-17(13-15-19)21-18(22)11-7-3-6-10-16-8-4-2-5-9-16/h4,8-9,17H,2-3,5-7,10-15H2,1H3,(H,21,22) |
| InChIKey | QIBTYCNGSCZACW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide?
The IUPAC name of 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide (CID 154665755) is 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide.
What is the SMILES notation for 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide?
The canonical SMILES for 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide is CC1(F)CCC(NC(=O)CCCCCC2=CCCC=C2)CC1.
What is the InChIKey of 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide?
The InChIKey is QIBTYCNGSCZACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30FNO/c1-19(20)14-12-17(13-15-19)21-18(22)11-7-3-6-10-16-8-4-2-5-9-16/h4,8-9,17H,2-3,5-7,10-15H2,1H3,(H,21,22).
What are the key properties of 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide?
6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide has a molecular weight of 307.45 g/mol, XLogP of 5.00, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclohexa-1,5-dien-1-yl-N-(4-fluoro-4-methylcyclohexyl)hexanamide is sourced from PubChem (CID 154665755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).