C17H25NO3 — CID 154666023
4-phenylbutyl N-(4-hydroxycyclohexyl)carbamate (PubChem CID 154666023) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-phenylbutyl N-(4-hydroxycyclohexyl)carbamate.
| Compound Name | 4-phenylbutyl N-(4-hydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 154666023 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-phenylbutyl N-(4-hydroxycyclohexyl)carbamate |
| SMILES | O=C(NC1CCC(O)CC1)OCCCCc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c19-16-11-9-15(10-12-16)18-17(20)21-13-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,15-16,19H,4-5,8-13H2,(H,18,20) |
| InChIKey | QTLZJDPJJPBROA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|