C24H27ClN2O3S — CID 154666068
N-[3-chloro-4-[4-[(3Z)-4-[1-(hydroxymethyl)cyclopropyl]-4-(methylideneamino)buta-1,3-dien-2-yl]thiophen-2-yl]phenyl]formamide;methoxycyclopropane (PubChem CID 154666068) has the molecular formula C24H27ClN2O3S and a molecular weight of 459.01 g/mol. Its IUPAC name is N-[3-chloro-4-[4-[(3Z)-4-[1-(hydroxymethyl)cyclopropyl]-4-(methylideneamino)buta-1,3-dien-2-yl]thiophen-2-yl]phenyl]formamide;methoxycyclopropane.
| Compound Name | N-[3-chloro-4-[4-[(3Z)-4-[1-(hydroxymethyl)cyclopropyl]-4-(methylideneamino)buta-1,3-dien-2-yl]thiophen-2-yl]phenyl]formamide;methoxycyclopropane |
|---|---|
| PubChem CID | 154666068 |
| Molecular Formula | C24H27ClN2O3S |
| Molecular Weight | 459.01 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-[3-chloro-4-[4-[(3Z)-4-[1-(hydroxymethyl)cyclopropyl]-4-(methylideneamino)buta-1,3-dien-2-yl]thiophen-2-yl]phenyl]formamide;methoxycyclopropane |
| SMILES | C=N/C(=C\C(=C)c1csc(-c2ccc(NC=O)cc2Cl)c1)C1(CO)CC1.COC1CC1 |
| InChI | InChI=1S/C20H19ClN2O2S.C4H8O/c1-13(7-19(22-2)20(11-24)5-6-20)14-8-18(26-10-14)16-4-3-15(23-12-25)9-17(16)21;1-5-4-2-3-4/h3-4,7-10,12,24H,1-2,5-6,11H2,(H,23,25);4H,2-3H2,1H3/b19-7-; |
| InChIKey | KSUHVFOIGMMWFW-LICXOGMASA-N |
| XLogP | 5.80 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.01 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|