C22H27ClN2O5S2 — CID 154666092
1,4-dioxan-2-ylmethyl (E)-3-[5-[2-chloro-4-(methanesulfonamido)phenyl]thiophen-3-yl]-N-methylpent-2-enimidate (PubChem CID 154666092) has the molecular formula C22H27ClN2O5S2 and a molecular weight of 499.05 g/mol. Its IUPAC name is 1,4-dioxan-2-ylmethyl (E)-3-[5-[2-chloro-4-(methanesulfonamido)phenyl]thiophen-3-yl]-N-methylpent-2-enimidate.
| Compound Name | 1,4-dioxan-2-ylmethyl (E)-3-[5-[2-chloro-4-(methanesulfonamido)phenyl]thiophen-3-yl]-N-methylpent-2-enimidate |
|---|---|
| PubChem CID | 154666092 |
| Molecular Formula | C22H27ClN2O5S2 |
| Molecular Weight | 499.05 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 1,4-dioxan-2-ylmethyl (E)-3-[5-[2-chloro-4-(methanesulfonamido)phenyl]thiophen-3-yl]-N-methylpent-2-enimidate |
| SMILES | CC/C(=C\C(=N\C)OCC1COCCO1)c1csc(-c2ccc(NS(C)(=O)=O)cc2Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O5S2/c1-4-15(10-22(24-2)30-13-18-12-28-7-8-29-18)16-9-21(31-14-16)19-6-5-17(11-20(19)23)25-32(3,26)27/h5-6,9-11,14,18,25H,4,7-8,12-13H2,1-3H3/b15-10+,24-22- |
| InChIKey | MLUFCLWLQOYSQQ-WMNLTWBHSA-N |
| XLogP | 4.69 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.05 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|