C21H28N4O — CID 154666850
N-[2-[(Z)-1-[3-(2,6-dimethyl-4-pyridinyl)phenyl]prop-1-enyl]iminoethyl]formamide;ethanamine (PubChem CID 154666850) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-[(Z)-1-[3-(2,6-dimethyl-4-pyridinyl)phenyl]prop-1-enyl]iminoethyl]formamide;ethanamine.
| Compound Name | N-[2-[(Z)-1-[3-(2,6-dimethyl-4-pyridinyl)phenyl]prop-1-enyl]iminoethyl]formamide;ethanamine |
|---|---|
| PubChem CID | 154666850 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[2-[(Z)-1-[3-(2,6-dimethyl-4-pyridinyl)phenyl]prop-1-enyl]iminoethyl]formamide;ethanamine |
| SMILES | C/C=C(\N=C\CNC=O)c1cccc(-c2cc(C)nc(C)c2)c1.CCN |
| InChI | InChI=1S/C19H21N3O.C2H7N/c1-4-19(21-9-8-20-13-23)17-7-5-6-16(12-17)18-10-14(2)22-15(3)11-18;1-2-3/h4-7,9-13H,8H2,1-3H3,(H,20,23);2-3H2,1H3/b19-4-,21-9+; |
| InChIKey | KKBCDHBHFYONJL-VZDZXOMNSA-N |
| XLogP | 3.51 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|