About tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen
tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen (PubChem CID 154666888) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen |
| PubChem CID | 154666888 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen |
| SMILES | CC1=CC(C(=O)OC(C)(C)C)=CC1.[H][H] |
| InChI | InChI=1S/C11H16O2.H2/c1-8-5-6-9(7-8)10(12)13-11(2,3)4;/h6-7H,5H2,1-4H3;1H |
| InChIKey | ZAAIMWHJOBYKMV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen?
The IUPAC name of tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen (CID 154666888) is tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen.
What is the SMILES notation for tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen?
The canonical SMILES for tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen is CC1=CC(C(=O)OC(C)(C)C)=CC1.[H][H].
What is the InChIKey of tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen?
The InChIKey is ZAAIMWHJOBYKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.H2/c1-8-5-6-9(7-8)10(12)13-11(2,3)4;/h6-7H,5H2,1-4H3;1H.
What are the key properties of tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen?
tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen has a molecular weight of 182.26 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-methylcyclopenta-1,4-diene-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 154666888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).