About 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine
2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine (PubChem CID 154666973) has the molecular formula C11H15FN2
and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine |
| PubChem CID | 154666973 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine |
| SMILES | C=C(CNC)N(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H15FN2/c1-9(8-13-2)14(3)11-6-4-10(12)5-7-11/h4-7,13H,1,8H2,2-3H3 |
| InChIKey | NBOBSVQESYNUQU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine?
The IUPAC name of 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine (CID 154666973) is 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine.
What is the SMILES notation for 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine?
The canonical SMILES for 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine is C=C(CNC)N(C)c1ccc(F)cc1.
What is the InChIKey of 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine?
The InChIKey is NBOBSVQESYNUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2/c1-9(8-13-2)14(3)11-6-4-10(12)5-7-11/h4-7,13H,1,8H2,2-3H3.
What are the key properties of 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine?
2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine has a molecular weight of 194.25 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-fluorophenyl)-1-N,2-N-dimethylprop-2-ene-1,2-diamine is sourced from PubChem (CID 154666973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).