C12H18Br2 — CID 15466704
(1R,4S,6R,9S)-5,10-bis(bromomethyl)tricyclo[7.1.0.04,6]decane (PubChem CID 15466704) has the molecular formula C12H18Br2 and a molecular weight of 322.08 g/mol. Its IUPAC name is (1R,4S,6R,9S)-5,10-bis(bromomethyl)tricyclo[7.1.0.04,6]decane.
| Compound Name | (1R,4S,6R,9S)-5,10-bis(bromomethyl)tricyclo[7.1.0.04,6]decane |
|---|---|
| PubChem CID | 15466704 |
| Molecular Formula | C12H18Br2 |
| Molecular Weight | 322.08 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | (1R,4S,6R,9S)-5,10-bis(bromomethyl)tricyclo[7.1.0.04,6]decane |
| SMILES | BrCC1[C@H]2CC[C@H]3C(CBr)[C@H]3CC[C@@H]12 |
| InChI | InChI=1S/C12H18Br2/c13-5-11-7-1-2-8-10(12(8)6-14)4-3-9(7)11/h7-12H,1-6H2/t7-,8+,9+,10-,11?,12? |
| InChIKey | PEDMDZHOSBHAKQ-GEDKWGBFSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.08 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|