C11H11NO3 — CID 154667051
methyl N-(2-methyl-1-benzofuran-5-yl)carbamate (PubChem CID 154667051) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is methyl N-(2-methyl-1-benzofuran-5-yl)carbamate.
| Compound Name | methyl N-(2-methyl-1-benzofuran-5-yl)carbamate |
|---|---|
| PubChem CID | 154667051 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | methyl N-(2-methyl-1-benzofuran-5-yl)carbamate |
| SMILES | COC(=O)Nc1ccc2oc(C)cc2c1 |
| InChI | InChI=1S/C11H11NO3/c1-7-5-8-6-9(12-11(13)14-2)3-4-10(8)15-7/h3-6H,1-2H3,(H,12,13) |
| InChIKey | RRIGTCZRXXLWAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |