About 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one
6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one (PubChem CID 154667168) has the molecular formula C24H20F2N4O2
and a molecular weight of 434.45 g/mol. Its IUPAC name is 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one.
Molecular Properties
| Compound Name | 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one |
| PubChem CID | 154667168 |
| Molecular Formula | C24H20F2N4O2 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one |
| SMILES | Cn1ncc2cc(-c3cccc4cc(C(=O)N5CCC(F)(F)CC5)cnc34)ccc2c1=O |
| InChI | InChI=1S/C24H20F2N4O2/c1-29-23(32)20-6-5-15(11-17(20)14-28-29)19-4-2-3-16-12-18(13-27-21(16)19)22(31)30-9-7-24(25,26)8-10-30/h2-6,11-14H,7-10H2,1H3 |
| InChIKey | DTYSSCQHJNFFLD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one?
The IUPAC name of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one (CID 154667168) is 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one.
What is the SMILES notation for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one?
The canonical SMILES for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one is Cn1ncc2cc(-c3cccc4cc(C(=O)N5CCC(F)(F)CC5)cnc34)ccc2c1=O.
What is the InChIKey of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one?
The InChIKey is DTYSSCQHJNFFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20F2N4O2/c1-29-23(32)20-6-5-15(11-17(20)14-28-29)19-4-2-3-16-12-18(13-27-21(16)19)22(31)30-9-7-24(25,26)8-10-30/h2-6,11-14H,7-10H2,1H3.
What are the key properties of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one?
6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one has a molecular weight of 434.45 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-2-methylphthalazin-1-one is sourced from PubChem (CID 154667168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).