About 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid
5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid (PubChem CID 154667297) has the molecular formula C22H17F3N2O3
and a molecular weight of 414.38 g/mol. Its IUPAC name is 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid |
| PubChem CID | 154667297 |
| Molecular Formula | C22H17F3N2O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(-c2cccc3cc(C(=O)N4CCC(F)(F)CC4)ccc23)cc1F |
| InChI | InChI=1S/C22H17F3N2O3/c23-18-11-15(12-26-19(18)21(29)30)16-3-1-2-13-10-14(4-5-17(13)16)20(28)27-8-6-22(24,25)7-9-27/h1-5,10-12H,6-9H2,(H,29,30) |
| InChIKey | WTPNUCICVGBUBG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid?
The IUPAC name of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid (CID 154667297) is 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid.
What is the SMILES notation for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid?
The canonical SMILES for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid is O=C(O)c1ncc(-c2cccc3cc(C(=O)N4CCC(F)(F)CC4)ccc23)cc1F.
What is the InChIKey of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid?
The InChIKey is WTPNUCICVGBUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3N2O3/c23-18-11-15(12-26-19(18)21(29)30)16-3-1-2-13-10-14(4-5-17(13)16)20(28)27-8-6-22(24,25)7-9-27/h1-5,10-12H,6-9H2,(H,29,30).
What are the key properties of 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid?
5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid has a molecular weight of 414.38 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(4,4-difluoropiperidine-1-carbonyl)naphthalen-1-yl]-3-fluoropyridine-2-carboxylic acid is sourced from PubChem (CID 154667297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).