About 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one
6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one (PubChem CID 154667365) has the molecular formula C22H17F2N3O3
and a molecular weight of 409.39 g/mol. Its IUPAC name is 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one.
Molecular Properties
| Compound Name | 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one |
| PubChem CID | 154667365 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one |
| SMILES | O=C(c1cnc2c(-c3ccc4c(=O)[nH]oc4c3)cccc2c1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H17F2N3O3/c23-22(24)6-8-27(9-7-22)21(29)15-10-14-2-1-3-16(19(14)25-12-15)13-4-5-17-18(11-13)30-26-20(17)28/h1-5,10-12H,6-9H2,(H,26,28) |
| InChIKey | HXKQMFFZFRBIHU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one?
The IUPAC name of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one (CID 154667365) is 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one.
What is the SMILES notation for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one?
The canonical SMILES for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one is O=C(c1cnc2c(-c3ccc4c(=O)[nH]oc4c3)cccc2c1)N1CCC(F)(F)CC1.
What is the InChIKey of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one?
The InChIKey is HXKQMFFZFRBIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2N3O3/c23-22(24)6-8-27(9-7-22)21(29)15-10-14-2-1-3-16(19(14)25-12-15)13-4-5-17-18(11-13)30-26-20(17)28/h1-5,10-12H,6-9H2,(H,26,28).
What are the key properties of 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one?
6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one has a molecular weight of 409.39 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4,4-difluoropiperidine-1-carbonyl)quinolin-8-yl]-1,2-benzoxazol-3-one is sourced from PubChem (CID 154667365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).